C28H29Cl2N5O3 — CID 69237533
1-amino-3-[4-[bis(2-chloroethyl)amino]-3-[2-(2,4-dimethoxyphenyl)quinolin-4-yl]phenyl]urea (PubChem CID 69237533) has the molecular formula C28H29Cl2N5O3 and a molecular weight of 554.48 g/mol. Its IUPAC name is 1-amino-3-[4-[bis(2-chloroethyl)amino]-3-[2-(2,4-dimethoxyphenyl)quinolin-4-yl]phenyl]urea.
| Compound Name | 1-amino-3-[4-[bis(2-chloroethyl)amino]-3-[2-(2,4-dimethoxyphenyl)quinolin-4-yl]phenyl]urea |
|---|---|
| PubChem CID | 69237533 |
| Molecular Formula | C28H29Cl2N5O3 |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 1-amino-3-[4-[bis(2-chloroethyl)amino]-3-[2-(2,4-dimethoxyphenyl)quinolin-4-yl]phenyl]urea |
| SMILES | COc1ccc(-c2cc(-c3cc(NC(=O)NN)ccc3N(CCCl)CCCl)c3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C28H29Cl2N5O3/c1-37-19-8-9-21(27(16-19)38-2)25-17-22(20-5-3-4-6-24(20)33-25)23-15-18(32-28(36)34-31)7-10-26(23)35(13-11-29)14-12-30/h3-10,15-17H,11-14,31H2,1-2H3,(H2,32,34,36) |
| InChIKey | UUDZTHVLZJIJSA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|