C27H27Cl2N5O — CID 69236851
1-amino-3-[4-[bis(2-chloroethyl)amino]-3-[2-(2-methylphenyl)quinolin-4-yl]phenyl]urea (PubChem CID 69236851) has the molecular formula C27H27Cl2N5O and a molecular weight of 508.45 g/mol. Its IUPAC name is 1-amino-3-[4-[bis(2-chloroethyl)amino]-3-[2-(2-methylphenyl)quinolin-4-yl]phenyl]urea.
| Compound Name | 1-amino-3-[4-[bis(2-chloroethyl)amino]-3-[2-(2-methylphenyl)quinolin-4-yl]phenyl]urea |
|---|---|
| PubChem CID | 69236851 |
| Molecular Formula | C27H27Cl2N5O |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 1-amino-3-[4-[bis(2-chloroethyl)amino]-3-[2-(2-methylphenyl)quinolin-4-yl]phenyl]urea |
| SMILES | Cc1ccccc1-c1cc(-c2cc(NC(=O)NN)ccc2N(CCCl)CCCl)c2ccccc2n1 |
| InChI | InChI=1S/C27H27Cl2N5O/c1-18-6-2-3-7-20(18)25-17-22(21-8-4-5-9-24(21)32-25)23-16-19(31-27(35)33-30)10-11-26(23)34(14-12-28)15-13-29/h2-11,16-17H,12-15,30H2,1H3,(H2,31,33,35) |
| InChIKey | GDQCYQGHKDAQQF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|