C26H23Cl2F2N5O — CID 69236530
1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[[2-(2,4-difluorophenyl)quinolin-4-yl]amino]urea (PubChem CID 69236530) has the molecular formula C26H23Cl2F2N5O and a molecular weight of 530.41 g/mol. Its IUPAC name is 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[[2-(2,4-difluorophenyl)quinolin-4-yl]amino]urea.
| Compound Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[[2-(2,4-difluorophenyl)quinolin-4-yl]amino]urea |
|---|---|
| PubChem CID | 69236530 |
| Molecular Formula | C26H23Cl2F2N5O |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[[2-(2,4-difluorophenyl)quinolin-4-yl]amino]urea |
| SMILES | O=C(NNc1cc(-c2ccc(F)cc2F)nc2ccccc12)Nc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C26H23Cl2F2N5O/c27-11-13-35(14-12-28)19-8-6-18(7-9-19)31-26(36)34-33-25-16-24(20-10-5-17(29)15-22(20)30)32-23-4-2-1-3-21(23)25/h1-10,15-16H,11-14H2,(H,32,33)(H2,31,34,36) |
| InChIKey | KCQQSRQCQMPEDU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|