C26H24Cl2N4O — CID 3025709
N-[4-[bis(2-chloroethyl)amino]phenyl]-4-(quinolin-4-ylamino)benzamide (PubChem CID 3025709) has the molecular formula C26H24Cl2N4O and a molecular weight of 479.41 g/mol. Its IUPAC name is N-[4-[bis(2-chloroethyl)amino]phenyl]-4-(quinolin-4-ylamino)benzamide.
| Compound Name | N-[4-[bis(2-chloroethyl)amino]phenyl]-4-(quinolin-4-ylamino)benzamide |
|---|---|
| PubChem CID | 3025709 |
| Molecular Formula | C26H24Cl2N4O |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N-[4-[bis(2-chloroethyl)amino]phenyl]-4-(quinolin-4-ylamino)benzamide |
| SMILES | O=C(Nc1ccc(N(CCCl)CCCl)cc1)c1ccc(Nc2ccnc3ccccc23)cc1 |
| InChI | InChI=1S/C26H24Cl2N4O/c27-14-17-32(18-15-28)22-11-9-21(10-12-22)31-26(33)19-5-7-20(8-6-19)30-25-13-16-29-24-4-2-1-3-23(24)25/h1-13,16H,14-15,17-18H2,(H,29,30)(H,31,33) |
| InChIKey | SIXDFBDGIXDONG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|