C27H26Cl2FN5O — CID 90682611
1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(4-fluoroanilino)-2-methylquinolin-6-yl]urea (PubChem CID 90682611) has the molecular formula C27H26Cl2FN5O and a molecular weight of 526.44 g/mol. Its IUPAC name is 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(4-fluoroanilino)-2-methylquinolin-6-yl]urea.
| Compound Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(4-fluoroanilino)-2-methylquinolin-6-yl]urea |
|---|---|
| PubChem CID | 90682611 |
| Molecular Formula | C27H26Cl2FN5O |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(4-fluoroanilino)-2-methylquinolin-6-yl]urea |
| SMILES | Cc1cc(Nc2ccc(F)cc2)c2cc(NC(=O)Nc3ccc(N(CCCl)CCCl)cc3)ccc2n1 |
| InChI | InChI=1S/C27H26Cl2FN5O/c1-18-16-26(32-20-4-2-19(30)3-5-20)24-17-22(8-11-25(24)31-18)34-27(36)33-21-6-9-23(10-7-21)35(14-12-28)15-13-29/h2-11,16-17H,12-15H2,1H3,(H,31,32)(H2,33,34,36) |
| InChIKey | FETXRTIOKHCVNM-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|