C25H28Cl2N10O2 — CID 70100773
N-[4-[bis(2-chloroethyl)amino]phenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-5-methyl-1H-imidazol-2-yl]-3H-benzimidazole-5-carboxamide (PubChem CID 70100773) has the molecular formula C25H28Cl2N10O2 and a molecular weight of 571.47 g/mol. Its IUPAC name is N-[4-[bis(2-chloroethyl)amino]phenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-5-methyl-1H-imidazol-2-yl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[4-[bis(2-chloroethyl)amino]phenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-5-methyl-1H-imidazol-2-yl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70100773 |
| Molecular Formula | C25H28Cl2N10O2 |
| Molecular Weight | 571.47 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | N-[4-[bis(2-chloroethyl)amino]phenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-5-methyl-1H-imidazol-2-yl]-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1[nH]c(-c2nc3ccc(C(=O)Nc4ccc(N(CCCl)CCCl)cc4)cc3[nH]2)nc1NC(=O)CN=C(N)N |
| InChI | InChI=1S/C25H28Cl2N10O2/c1-14-21(35-20(38)13-30-25(28)29)36-22(31-14)23-33-18-7-2-15(12-19(18)34-23)24(39)32-16-3-5-17(6-4-16)37(10-8-26)11-9-27/h2-7,12H,8-11,13H2,1H3,(H,31,36)(H,32,39)(H,33,34)(H,35,38)(H4,28,29,30) |
| InChIKey | ATDUHFPPOOJLAV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 183.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|