C27H31Cl2N9O2 — CID 70102457
N-[4-[bis(2-chloroethyl)amino]-3-methylphenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide (PubChem CID 70102457) has the molecular formula C27H31Cl2N9O2 and a molecular weight of 584.51 g/mol. Its IUPAC name is N-[4-[bis(2-chloroethyl)amino]-3-methylphenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[4-[bis(2-chloroethyl)amino]-3-methylphenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70102457 |
| Molecular Formula | C27H31Cl2N9O2 |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | N-[4-[bis(2-chloroethyl)amino]-3-methylphenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc3nc(-c4cc(NC(=O)CN=C(N)N)cn4C)[nH]c3c2)ccc1N(CCCl)CCCl |
| InChI | InChI=1S/C27H31Cl2N9O2/c1-16-11-18(4-6-22(16)38(9-7-28)10-8-29)34-26(40)17-3-5-20-21(12-17)36-25(35-20)23-13-19(15-37(23)2)33-24(39)14-32-27(30)31/h3-6,11-13,15H,7-10,14H2,1-2H3,(H,33,39)(H,34,40)(H,35,36)(H4,30,31,32) |
| InChIKey | VJWVYPPCMWOSAU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|