C27H33Cl4N9O3 — CID 70103511
N-[4-[bis(2-chloroethyl)amino]-3-methoxyphenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide;dihydrochloride (PubChem CID 70103511) has the molecular formula C27H33Cl4N9O3 and a molecular weight of 673.43 g/mol. Its IUPAC name is N-[4-[bis(2-chloroethyl)amino]-3-methoxyphenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide;dihydrochloride.
| Compound Name | N-[4-[bis(2-chloroethyl)amino]-3-methoxyphenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 70103511 |
| Molecular Formula | C27H33Cl4N9O3 |
| Molecular Weight | 673.43 g/mol |
| Exact Mass | 671.15 |
| IUPAC Name | N-[4-[bis(2-chloroethyl)amino]-3-methoxyphenyl]-2-[4-[[2-(diaminomethylideneamino)acetyl]amino]-1-methylpyrrol-2-yl]-3H-benzimidazole-5-carboxamide;dihydrochloride |
| SMILES | COc1cc(NC(=O)c2ccc3nc(-c4cc(NC(=O)CN=C(N)N)cn4C)[nH]c3c2)ccc1N(CCCl)CCCl.Cl.Cl |
| InChI | InChI=1S/C27H31Cl2N9O3.2ClH/c1-37-15-18(33-24(39)14-32-27(30)31)12-22(37)25-35-19-5-3-16(11-20(19)36-25)26(40)34-17-4-6-21(23(13-17)41-2)38(9-7-28)10-8-29;;/h3-6,11-13,15H,7-10,14H2,1-2H3,(H,33,39)(H,34,40)(H,35,36)(H4,30,31,32);2*1H |
| InChIKey | GCRNQLMBBAFNPE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 168.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|