C24H24N4O — CID 141205717
2-(4-amino-2,6-dimethylphenyl)-N-(3,4-dimethylphenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 141205717) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-(4-amino-2,6-dimethylphenyl)-N-(3,4-dimethylphenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(4-amino-2,6-dimethylphenyl)-N-(3,4-dimethylphenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 141205717 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-(4-amino-2,6-dimethylphenyl)-N-(3,4-dimethylphenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3nc(-c4c(C)cc(N)cc4C)[nH]c3c2)cc1C |
| InChI | InChI=1S/C24H24N4O/c1-13-5-7-19(11-14(13)2)26-24(29)17-6-8-20-21(12-17)28-23(27-20)22-15(3)9-18(25)10-16(22)4/h5-12H,25H2,1-4H3,(H,26,29)(H,27,28) |
| InChIKey | QOVSLTCVRYJRFP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|