C18H19N3O2 — CID 25065962
ethyl N-[2-(2,6-dimethylphenyl)-3H-benzimidazol-5-yl]carbamate (PubChem CID 25065962) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is ethyl N-[2-(2,6-dimethylphenyl)-3H-benzimidazol-5-yl]carbamate.
| Compound Name | ethyl N-[2-(2,6-dimethylphenyl)-3H-benzimidazol-5-yl]carbamate |
|---|---|
| PubChem CID | 25065962 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | ethyl N-[2-(2,6-dimethylphenyl)-3H-benzimidazol-5-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2nc(-c3c(C)cccc3C)[nH]c2c1 |
| InChI | InChI=1S/C18H19N3O2/c1-4-23-18(22)19-13-8-9-14-15(10-13)21-17(20-14)16-11(2)6-5-7-12(16)3/h5-10H,4H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | AHKMWLGXNMVLDS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |