C20H23N3O — CID 143659496
2-(2,6-dimethylphenyl)-N,N-diethyl-3H-benzimidazole-5-carboxamide (PubChem CID 143659496) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-N,N-diethyl-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(2,6-dimethylphenyl)-N,N-diethyl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 143659496 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-N,N-diethyl-3H-benzimidazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc2nc(-c3c(C)cccc3C)[nH]c2c1 |
| InChI | InChI=1S/C20H23N3O/c1-5-23(6-2)20(24)15-10-11-16-17(12-15)22-19(21-16)18-13(3)8-7-9-14(18)4/h7-12H,5-6H2,1-4H3,(H,21,22) |
| InChIKey | RJEUFFOTQXQLNG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |