C17H15Cl2N3O — CID 25066170
N-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]butanamide (PubChem CID 25066170) has the molecular formula C17H15Cl2N3O and a molecular weight of 348.23 g/mol. Its IUPAC name is N-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]butanamide.
| Compound Name | N-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]butanamide |
|---|---|
| PubChem CID | 25066170 |
| Molecular Formula | C17H15Cl2N3O |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2nc(-c3c(Cl)cccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C17H15Cl2N3O/c1-2-4-15(23)20-10-7-8-13-14(9-10)22-17(21-13)16-11(18)5-3-6-12(16)19/h3,5-9H,2,4H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | ZYYNHYNFBGFGRG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |