C32H40N4O2 — CID 142813043
benzene;N-[2-[4-(butanoylamino)phenyl]-3H-benzimidazol-5-yl]-2,3-diethylpentanamide (PubChem CID 142813043) has the molecular formula C32H40N4O2 and a molecular weight of 512.70 g/mol. Its IUPAC name is benzene;N-[2-[4-(butanoylamino)phenyl]-3H-benzimidazol-5-yl]-2,3-diethylpentanamide.
| Compound Name | benzene;N-[2-[4-(butanoylamino)phenyl]-3H-benzimidazol-5-yl]-2,3-diethylpentanamide |
|---|---|
| PubChem CID | 142813043 |
| Molecular Formula | C32H40N4O2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | benzene;N-[2-[4-(butanoylamino)phenyl]-3H-benzimidazol-5-yl]-2,3-diethylpentanamide |
| SMILES | CCCC(=O)Nc1ccc(-c2nc3ccc(NC(=O)C(CC)C(CC)CC)cc3[nH]2)cc1.c1ccccc1 |
| InChI | InChI=1S/C26H34N4O2.C6H6/c1-5-9-24(31)27-19-12-10-18(11-13-19)25-29-22-15-14-20(16-23(22)30-25)28-26(32)21(8-4)17(6-2)7-3;1-2-4-6-5-3-1/h10-17,21H,5-9H2,1-4H3,(H,27,31)(H,28,32)(H,29,30);1-6H |
| InChIKey | ACOASRLFCQMVDS-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |