C18H17Cl2N3O — CID 25066171
N-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-3-methylbutanamide (PubChem CID 25066171) has the molecular formula C18H17Cl2N3O and a molecular weight of 362.26 g/mol. Its IUPAC name is N-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-3-methylbutanamide.
| Compound Name | N-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 25066171 |
| Molecular Formula | C18H17Cl2N3O |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N-[2-(2,6-dichlorophenyl)-3H-benzimidazol-5-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc2nc(-c3c(Cl)cccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C18H17Cl2N3O/c1-10(2)8-16(24)21-11-6-7-14-15(9-11)23-18(22-14)17-12(19)4-3-5-13(17)20/h3-7,9-10H,8H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | SNDPNPSGGLBSRS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |