C21H13Cl2N3O3 — CID 68935401
3-[[2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carbonyl]amino]benzoic acid (PubChem CID 68935401) has the molecular formula C21H13Cl2N3O3 and a molecular weight of 426.26 g/mol. Its IUPAC name is 3-[[2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 68935401 |
| Molecular Formula | C21H13Cl2N3O3 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 3-[[2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2ccc3nc(-c4c(Cl)cccc4Cl)[nH]c3c2)c1 |
| InChI | InChI=1S/C21H13Cl2N3O3/c22-14-5-2-6-15(23)18(14)19-25-16-8-7-11(10-17(16)26-19)20(27)24-13-4-1-3-12(9-13)21(28)29/h1-10H,(H,24,27)(H,25,26)(H,28,29) |
| InChIKey | FVXPMXPBCUGOEN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |