C26H23Cl2N3O — CID 66965413
N-(4-cyclohexylphenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide (PubChem CID 66965413) has the molecular formula C26H23Cl2N3O and a molecular weight of 464.40 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(4-cyclohexylphenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 66965413 |
| Molecular Formula | C26H23Cl2N3O |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | N-(4-cyclohexylphenyl)-2-(2,6-dichlorophenyl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cc1)c1ccc2nc(-c3c(Cl)cccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C26H23Cl2N3O/c27-20-7-4-8-21(28)24(20)25-30-22-14-11-18(15-23(22)31-25)26(32)29-19-12-9-17(10-13-19)16-5-2-1-3-6-16/h4,7-16H,1-3,5-6H2,(H,29,32)(H,30,31) |
| InChIKey | NFVNRHLVPVKQNN-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |