C21H27N3O4S2 — CID 35506386
N,N-diethyl-3-[[[2-[(3-methylphenyl)methylsulfanyl]acetyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 35506386) has the molecular formula C21H27N3O4S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is N,N-diethyl-3-[[[2-[(3-methylphenyl)methylsulfanyl]acetyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[[[2-[(3-methylphenyl)methylsulfanyl]acetyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35506386 |
| Molecular Formula | C21H27N3O4S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N,N-diethyl-3-[[[2-[(3-methylphenyl)methylsulfanyl]acetyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NNC(=O)CSCc2cccc(C)c2)c1 |
| InChI | InChI=1S/C21H27N3O4S2/c1-4-24(5-2)30(27,28)19-11-7-10-18(13-19)21(26)23-22-20(25)15-29-14-17-9-6-8-16(3)12-17/h6-13H,4-5,14-15H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | LGOKBBCSAHQQEV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|