C19H21Cl2N3O5S — CID 30476036
3-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide (PubChem CID 30476036) has the molecular formula C19H21Cl2N3O5S and a molecular weight of 474.37 g/mol. Its IUPAC name is 3-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 30476036 |
| Molecular Formula | C19H21Cl2N3O5S |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 3-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NNC(=O)COc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C19H21Cl2N3O5S/c1-3-24(4-2)30(27,28)15-7-5-6-13(10-15)19(26)23-22-18(25)12-29-17-9-8-14(20)11-16(17)21/h5-11H,3-4,12H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | ZMOKFKUEDPHFBC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|