C23H31N3O5S — CID 55486046
3-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide (PubChem CID 55486046) has the molecular formula C23H31N3O5S and a molecular weight of 461.58 g/mol. Its IUPAC name is 3-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55486046 |
| Molecular Formula | C23H31N3O5S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 3-[[[2-(2-butan-2-ylphenoxy)acetyl]amino]carbamoyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCC(C)c1ccccc1OCC(=O)NNC(=O)c1cccc(S(=O)(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C23H31N3O5S/c1-5-17(4)20-13-8-9-14-21(20)31-16-22(27)24-25-23(28)18-11-10-12-19(15-18)32(29,30)26(6-2)7-3/h8-15,17H,5-7,16H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | SLCMZZIAGNPLFR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|