C25H34N2O6 — CID 55486518
N'-[2-(2-butan-2-ylphenoxy)acetyl]-3,4,5-triethoxybenzohydrazide (PubChem CID 55486518) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is N'-[2-(2-butan-2-ylphenoxy)acetyl]-3,4,5-triethoxybenzohydrazide.
| Compound Name | N'-[2-(2-butan-2-ylphenoxy)acetyl]-3,4,5-triethoxybenzohydrazide |
|---|---|
| PubChem CID | 55486518 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N'-[2-(2-butan-2-ylphenoxy)acetyl]-3,4,5-triethoxybenzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)COc2ccccc2C(C)CC)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H34N2O6/c1-6-17(5)19-12-10-11-13-20(19)33-16-23(28)26-27-25(29)18-14-21(30-7-2)24(32-9-4)22(15-18)31-8-3/h10-15,17H,6-9,16H2,1-5H3,(H,26,28)(H,27,29) |
| InChIKey | HIVUGJJPZQEGPO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|