C19H19Cl2N3O4S2 — CID 3581706
2-(2,4-dichlorophenoxy)-N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]acetamide (PubChem CID 3581706) has the molecular formula C19H19Cl2N3O4S2 and a molecular weight of 488.42 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3581706 |
| Molecular Formula | C19H19Cl2N3O4S2 |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nc(NC(=O)COc3ccc(Cl)cc3Cl)sc2c1 |
| InChI | InChI=1S/C19H19Cl2N3O4S2/c1-3-24(4-2)30(26,27)13-6-7-15-17(10-13)29-19(22-15)23-18(25)11-28-16-8-5-12(20)9-14(16)21/h5-10H,3-4,11H2,1-2H3,(H,22,23,25) |
| InChIKey | XDCLNSWIEMZDNM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |