C17H22N2O5S — CID 47821720
(4,5-dimethyl-1,3-oxazol-2-yl)methyl 3-(diethylsulfamoyl)benzoate (PubChem CID 47821720) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is (4,5-dimethyl-1,3-oxazol-2-yl)methyl 3-(diethylsulfamoyl)benzoate.
| Compound Name | (4,5-dimethyl-1,3-oxazol-2-yl)methyl 3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 47821720 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (4,5-dimethyl-1,3-oxazol-2-yl)methyl 3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)OCc2nc(C)c(C)o2)c1 |
| InChI | InChI=1S/C17H22N2O5S/c1-5-19(6-2)25(21,22)15-9-7-8-14(10-15)17(20)23-11-16-18-12(3)13(4)24-16/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | VSLOKGWPJDJOJM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |