C22H18Cl2N4O4 — CID 3710462
[4-[bis(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)methyl]phenyl] 3,4-dichlorobenzoate (PubChem CID 3710462) has the molecular formula C22H18Cl2N4O4 and a molecular weight of 473.32 g/mol. Its IUPAC name is [4-[bis(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)methyl]phenyl] 3,4-dichlorobenzoate.
| Compound Name | [4-[bis(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)methyl]phenyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3710462 |
| Molecular Formula | C22H18Cl2N4O4 |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | [4-[bis(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)methyl]phenyl] 3,4-dichlorobenzoate |
| SMILES | Cc1[nH][nH]c(=O)c1C(c1ccc(OC(=O)c2ccc(Cl)c(Cl)c2)cc1)c1c(C)[nH][nH]c1=O |
| InChI | InChI=1S/C22H18Cl2N4O4/c1-10-17(20(29)27-25-10)19(18-11(2)26-28-21(18)30)12-3-6-14(7-4-12)32-22(31)13-5-8-15(23)16(24)9-13/h3-9,19H,1-2H3,(H2,25,27,29)(H2,26,28,30) |
| InChIKey | AXGWZQGJHFIRPK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|