C23H22BrClN4O5 — CID 163329174
[4-[bis(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)methyl]-2-methoxyphenyl] 3-bromobenzoate;hydrochloride (PubChem CID 163329174) has the molecular formula C23H22BrClN4O5 and a molecular weight of 549.81 g/mol. Its IUPAC name is [4-[bis(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)methyl]-2-methoxyphenyl] 3-bromobenzoate;hydrochloride.
| Compound Name | [4-[bis(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)methyl]-2-methoxyphenyl] 3-bromobenzoate;hydrochloride |
|---|---|
| PubChem CID | 163329174 |
| Molecular Formula | C23H22BrClN4O5 |
| Molecular Weight | 549.81 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | [4-[bis(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)methyl]-2-methoxyphenyl] 3-bromobenzoate;hydrochloride |
| SMILES | COc1cc(C(c2c(C)[nH][nH]c2=O)c2c(C)[nH][nH]c2=O)ccc1OC(=O)c1cccc(Br)c1.Cl |
| InChI | InChI=1S/C23H21BrN4O5.ClH/c1-11-18(21(29)27-25-11)20(19-12(2)26-28-22(19)30)13-7-8-16(17(10-13)32-3)33-23(31)14-5-4-6-15(24)9-14;/h4-10,20H,1-3H3,(H2,25,27,29)(H2,26,28,30);1H |
| InChIKey | OSMPBCZFPVWUCE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.81 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|