C16H12Cl2O5 — CID 17391291
(5-methoxy-2-methoxycarbonylphenyl) 3,4-dichlorobenzoate (PubChem CID 17391291) has the molecular formula C16H12Cl2O5 and a molecular weight of 355.17 g/mol. Its IUPAC name is (5-methoxy-2-methoxycarbonylphenyl) 3,4-dichlorobenzoate.
| Compound Name | (5-methoxy-2-methoxycarbonylphenyl) 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 17391291 |
| Molecular Formula | C16H12Cl2O5 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | (5-methoxy-2-methoxycarbonylphenyl) 3,4-dichlorobenzoate |
| SMILES | COC(=O)c1ccc(OC)cc1OC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2O5/c1-21-10-4-5-11(16(20)22-2)14(8-10)23-15(19)9-3-6-12(17)13(18)7-9/h3-8H,1-2H3 |
| InChIKey | LYESRQUKLCDZFT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|