C26H20O2 — CID 5259949
(8-benzoyl-2,7-dimethylnaphthalen-1-yl)-phenylmethanone (PubChem CID 5259949) has the molecular formula C26H20O2 and a molecular weight of 364.44 g/mol. Its IUPAC name is (8-benzoyl-2,7-dimethylnaphthalen-1-yl)-phenylmethanone.
| Compound Name | (8-benzoyl-2,7-dimethylnaphthalen-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 5259949 |
| Molecular Formula | C26H20O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (8-benzoyl-2,7-dimethylnaphthalen-1-yl)-phenylmethanone |
| SMILES | Cc1ccc2ccc(C)c(C(=O)c3ccccc3)c2c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H20O2/c1-17-13-15-19-16-14-18(2)23(26(28)21-11-7-4-8-12-21)24(19)22(17)25(27)20-9-5-3-6-10-20/h3-16H,1-2H3 |
| InChIKey | KOBRBUSNHWVJJK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |