C16H17NO5 — CID 15856191
[3-(1,3-dihydroxypropan-2-ylamino)-2,4-dihydroxyphenyl]-phenylmethanone (PubChem CID 15856191) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is [3-(1,3-dihydroxypropan-2-ylamino)-2,4-dihydroxyphenyl]-phenylmethanone.
| Compound Name | [3-(1,3-dihydroxypropan-2-ylamino)-2,4-dihydroxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 15856191 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | [3-(1,3-dihydroxypropan-2-ylamino)-2,4-dihydroxyphenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(O)c(NC(CO)CO)c1O |
| InChI | InChI=1S/C16H17NO5/c18-8-11(9-19)17-14-13(20)7-6-12(16(14)22)15(21)10-4-2-1-3-5-10/h1-7,11,17-20,22H,8-9H2 |
| InChIKey | ZUYQBSAPJSDHFS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|