C15H11NO5 — CID 155516110
(4-hydroxy-1H-indol-3-yl)-(3,4,5-trihydroxyphenyl)methanone (PubChem CID 155516110) has the molecular formula C15H11NO5 and a molecular weight of 285.26 g/mol. Its IUPAC name is (4-hydroxy-1H-indol-3-yl)-(3,4,5-trihydroxyphenyl)methanone.
| Compound Name | (4-hydroxy-1H-indol-3-yl)-(3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 155516110 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | (4-hydroxy-1H-indol-3-yl)-(3,4,5-trihydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)c1c[nH]c2cccc(O)c12 |
| InChI | InChI=1S/C15H11NO5/c17-10-3-1-2-9-13(10)8(6-16-9)14(20)7-4-11(18)15(21)12(19)5-7/h1-6,16-19,21H |
| InChIKey | HNVXQWCTTSWTAE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|