C14H8FNO3 — CID 3079411
5-(2-fluorobenzoyl)-2,3-dihydroxybenzonitrile (PubChem CID 3079411) has the molecular formula C14H8FNO3 and a molecular weight of 257.22 g/mol. Its IUPAC name is 5-(2-fluorobenzoyl)-2,3-dihydroxybenzonitrile.
| Compound Name | 5-(2-fluorobenzoyl)-2,3-dihydroxybenzonitrile |
|---|---|
| PubChem CID | 3079411 |
| Molecular Formula | C14H8FNO3 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 5-(2-fluorobenzoyl)-2,3-dihydroxybenzonitrile |
| SMILES | N#Cc1cc(C(=O)c2ccccc2F)cc(O)c1O |
| InChI | InChI=1S/C14H8FNO3/c15-11-4-2-1-3-10(11)13(18)8-5-9(7-16)14(19)12(17)6-8/h1-6,17,19H |
| InChIKey | ZSTLBCUHYUTGRS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|