C15H9N3O2 — CID 56647959
2-amino-5-(2-hydroxybenzoyl)benzene-1,3-dicarbonitrile (PubChem CID 56647959) has the molecular formula C15H9N3O2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-amino-5-(2-hydroxybenzoyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-5-(2-hydroxybenzoyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 56647959 |
| Molecular Formula | C15H9N3O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2-amino-5-(2-hydroxybenzoyl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C(=O)c2ccccc2O)cc(C#N)c1N |
| InChI | InChI=1S/C15H9N3O2/c16-7-10-5-9(6-11(8-17)14(10)18)15(20)12-3-1-2-4-13(12)19/h1-6,19H,18H2 |
| InChIKey | MZCSVAJNERGHSK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|