C13H12N4O — CID 13355676
2-amino-5-[2-(cyclopropylamino)acetyl]benzene-1,3-dicarbonitrile (PubChem CID 13355676) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-amino-5-[2-(cyclopropylamino)acetyl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-5-[2-(cyclopropylamino)acetyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 13355676 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-amino-5-[2-(cyclopropylamino)acetyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C(=O)CNC2CC2)cc(C#N)c1N |
| InChI | InChI=1S/C13H12N4O/c14-5-9-3-8(4-10(6-15)13(9)16)12(18)7-17-11-1-2-11/h3-4,11,17H,1-2,7,16H2 |
| InChIKey | KNBUWDVAVRUYDV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|