C9H6BrNO3 — CID 21459065
5-(2-bromoacetyl)-2,3-dihydroxybenzonitrile (PubChem CID 21459065) has the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. Its IUPAC name is 5-(2-bromoacetyl)-2,3-dihydroxybenzonitrile.
| Compound Name | 5-(2-bromoacetyl)-2,3-dihydroxybenzonitrile |
|---|---|
| PubChem CID | 21459065 |
| Molecular Formula | C9H6BrNO3 |
| Molecular Weight | 256.05 g/mol |
| Exact Mass | 254.95 |
| IUPAC Name | 5-(2-bromoacetyl)-2,3-dihydroxybenzonitrile |
| SMILES | N#Cc1cc(C(=O)CBr)cc(O)c1O |
| InChI | InChI=1S/C9H6BrNO3/c10-3-8(13)5-1-6(4-11)9(14)7(12)2-5/h1-2,12,14H,3H2 |
| InChIKey | SYFAPMRHLKMQEP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.05 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|