C14H12O6 — CID 139707986
(2-hydroxy-5-methoxyphenyl)-(3,4,5-trihydroxyphenyl)methanone (PubChem CID 139707986) has the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. Its IUPAC name is (2-hydroxy-5-methoxyphenyl)-(3,4,5-trihydroxyphenyl)methanone.
| Compound Name | (2-hydroxy-5-methoxyphenyl)-(3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 139707986 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (2-hydroxy-5-methoxyphenyl)-(3,4,5-trihydroxyphenyl)methanone |
| SMILES | COc1ccc(O)c(C(=O)c2cc(O)c(O)c(O)c2)c1 |
| InChI | InChI=1S/C14H12O6/c1-20-8-2-3-10(15)9(6-8)13(18)7-4-11(16)14(19)12(17)5-7/h2-6,15-17,19H,1H3 |
| InChIKey | HWJVANASFVMAIG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|