About (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride
(2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride (PubChem CID 87794308) has the molecular formula C21H15ClI2O4
and a molecular weight of 620.61 g/mol. Its IUPAC name is (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride.
Molecular Properties
| Compound Name | (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride |
| PubChem CID | 87794308 |
| Molecular Formula | C21H15ClI2O4 |
| Molecular Weight | 620.61 g/mol |
| Exact Mass | 619.87 |
| IUPAC Name | (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride |
| SMILES | COc1ccc(O)c(C(=O)c2ccc(I)cc2)c1.O=C(Cl)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H11IO3.C7H4ClIO/c1-18-11-6-7-13(16)12(8-11)14(17)9-2-4-10(15)5-3-9;8-7(10)5-1-3-6(9)4-2-5/h2-8,16H,1H3;1-4H |
| InChIKey | AEYUUJXVLWYLFC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 620.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride?
The IUPAC name of (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride (CID 87794308) is (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride.
What is the SMILES notation for (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride?
The canonical SMILES for (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride is COc1ccc(O)c(C(=O)c2ccc(I)cc2)c1.O=C(Cl)c1ccc(I)cc1.
What is the InChIKey of (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride?
The InChIKey is AEYUUJXVLWYLFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11IO3.C7H4ClIO/c1-18-11-6-7-13(16)12(8-11)14(17)9-2-4-10(15)5-3-9;8-7(10)5-1-3-6(9)4-2-5/h2-8,16H,1H3;1-4H.
What are the key properties of (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride?
(2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride has a molecular weight of 620.61 g/mol, XLogP of 5.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-5-methoxyphenyl)-(4-iodophenyl)methanone;4-iodobenzoyl chloride is sourced from PubChem (CID 87794308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).