C12H16BrNO3 — CID 114345365
N-(3-bromobutyl)-2,3-dihydroxy-N-methylbenzamide (PubChem CID 114345365) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is N-(3-bromobutyl)-2,3-dihydroxy-N-methylbenzamide.
| Compound Name | N-(3-bromobutyl)-2,3-dihydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 114345365 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-(3-bromobutyl)-2,3-dihydroxy-N-methylbenzamide |
| SMILES | CC(Br)CCN(C)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C12H16BrNO3/c1-8(13)6-7-14(2)12(17)9-4-3-5-10(15)11(9)16/h3-5,8,15-16H,6-7H2,1-2H3 |
| InChIKey | MGVHOFXVPATBGW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|