C12H16BrNO2 — CID 80666341
N-(2-bromopropyl)-2-hydroxy-N,3-dimethylbenzamide (PubChem CID 80666341) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is N-(2-bromopropyl)-2-hydroxy-N,3-dimethylbenzamide.
| Compound Name | N-(2-bromopropyl)-2-hydroxy-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 80666341 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | N-(2-bromopropyl)-2-hydroxy-N,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)CC(C)Br)c1O |
| InChI | InChI=1S/C12H16BrNO2/c1-8-5-4-6-10(11(8)15)12(16)14(3)7-9(2)13/h4-6,9,15H,7H2,1-3H3 |
| InChIKey | AJTUPWGXJIAULR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|