C17H19NO3 — CID 61044662
2-hydroxy-N-[1-(2-hydroxyphenyl)ethyl]-N,3-dimethylbenzamide (PubChem CID 61044662) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-hydroxy-N-[1-(2-hydroxyphenyl)ethyl]-N,3-dimethylbenzamide.
| Compound Name | 2-hydroxy-N-[1-(2-hydroxyphenyl)ethyl]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 61044662 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-hydroxy-N-[1-(2-hydroxyphenyl)ethyl]-N,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)C(C)c2ccccc2O)c1O |
| InChI | InChI=1S/C17H19NO3/c1-11-7-6-9-14(16(11)20)17(21)18(3)12(2)13-8-4-5-10-15(13)19/h4-10,12,19-20H,1-3H3 |
| InChIKey | BAIOCWNJRGUACM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|