C12H14F3NO — CID 69057682
4-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 69057682) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is 4-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 69057682 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 4-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCc1ccc(C(=O)N(C)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO/c1-3-9-4-6-10(7-5-9)11(17)16(2)8-12(13,14)15/h4-7H,3,8H2,1-2H3 |
| InChIKey | PHWVTDIWGVXZBR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |