C13H13ClF3NO3 — CID 107492182
N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 107492182) has the molecular formula C13H13ClF3NO3 and a molecular weight of 323.70 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 107492182 |
| Molecular Formula | C13H13ClF3NO3 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | O=C(c1cccc2c1OCCO2)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C13H13ClF3NO3/c14-4-5-18(8-13(15,16)17)12(19)9-2-1-3-10-11(9)21-7-6-20-10/h1-3H,4-8H2 |
| InChIKey | SDKXBCLRBCJLIG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|