C9H8Cl2F3NO2 — CID 107492176
2-chloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)furan-3-carboxamide (PubChem CID 107492176) has the molecular formula C9H8Cl2F3NO2 and a molecular weight of 290.07 g/mol. Its IUPAC name is 2-chloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)furan-3-carboxamide.
| Compound Name | 2-chloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 107492176 |
| Molecular Formula | C9H8Cl2F3NO2 |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 2-chloro-N-(2-chloroethyl)-N-(2,2,2-trifluoroethyl)furan-3-carboxamide |
| SMILES | O=C(c1ccoc1Cl)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C9H8Cl2F3NO2/c10-2-3-15(5-9(12,13)14)8(16)6-1-4-17-7(6)11/h1,4H,2-3,5H2 |
| InChIKey | LDZLXVHBMXVXSP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|