C15H12ClNO4 — CID 106686174
2-chloro-N,N-bis(furan-2-ylmethyl)furan-3-carboxamide (PubChem CID 106686174) has the molecular formula C15H12ClNO4 and a molecular weight of 305.72 g/mol. Its IUPAC name is 2-chloro-N,N-bis(furan-2-ylmethyl)furan-3-carboxamide.
| Compound Name | 2-chloro-N,N-bis(furan-2-ylmethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106686174 |
| Molecular Formula | C15H12ClNO4 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-chloro-N,N-bis(furan-2-ylmethyl)furan-3-carboxamide |
| SMILES | O=C(c1ccoc1Cl)N(Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C15H12ClNO4/c16-14-13(5-8-21-14)15(18)17(9-11-3-1-6-19-11)10-12-4-2-7-20-12/h1-8H,9-10H2 |
| InChIKey | QMDVGUCAHJAWSQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |