C9H6ClN3O2 — CID 106685237
2-chloro-N,N-bis(cyanomethyl)furan-3-carboxamide (PubChem CID 106685237) has the molecular formula C9H6ClN3O2 and a molecular weight of 223.62 g/mol. Its IUPAC name is 2-chloro-N,N-bis(cyanomethyl)furan-3-carboxamide.
| Compound Name | 2-chloro-N,N-bis(cyanomethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106685237 |
| Molecular Formula | C9H6ClN3O2 |
| Molecular Weight | 223.62 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 2-chloro-N,N-bis(cyanomethyl)furan-3-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)c1ccoc1Cl |
| InChI | InChI=1S/C9H6ClN3O2/c10-8-7(1-6-15-8)9(14)13(4-2-11)5-3-12/h1,6H,4-5H2 |
| InChIKey | XIWZLHDHPMGWFY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.62 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|