C11H9ClN4O — CID 112574281
3-amino-2-chloro-N,N-bis(cyanomethyl)benzamide (PubChem CID 112574281) has the molecular formula C11H9ClN4O and a molecular weight of 248.67 g/mol. Its IUPAC name is 3-amino-2-chloro-N,N-bis(cyanomethyl)benzamide.
| Compound Name | 3-amino-2-chloro-N,N-bis(cyanomethyl)benzamide |
|---|---|
| PubChem CID | 112574281 |
| Molecular Formula | C11H9ClN4O |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 3-amino-2-chloro-N,N-bis(cyanomethyl)benzamide |
| SMILES | N#CCN(CC#N)C(=O)c1cccc(N)c1Cl |
| InChI | InChI=1S/C11H9ClN4O/c12-10-8(2-1-3-9(10)15)11(17)16(6-4-13)7-5-14/h1-3H,6-7,15H2 |
| InChIKey | MFCPLGJSXCSBCZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|