C11H15ClN2O3 — CID 112575679
3-amino-2-chloro-N,N-bis(2-hydroxyethyl)benzamide (PubChem CID 112575679) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. Its IUPAC name is 3-amino-2-chloro-N,N-bis(2-hydroxyethyl)benzamide.
| Compound Name | 3-amino-2-chloro-N,N-bis(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 112575679 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-amino-2-chloro-N,N-bis(2-hydroxyethyl)benzamide |
| SMILES | Nc1cccc(C(=O)N(CCO)CCO)c1Cl |
| InChI | InChI=1S/C11H15ClN2O3/c12-10-8(2-1-3-9(10)13)11(17)14(4-6-15)5-7-16/h1-3,15-16H,4-7,13H2 |
| InChIKey | HEGOTUUPLKVSML-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|