C14H11ClF3NO2 — CID 106686196
N-benzyl-2-chloro-N-(2,2,2-trifluoroethyl)furan-3-carboxamide (PubChem CID 106686196) has the molecular formula C14H11ClF3NO2 and a molecular weight of 317.69 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-(2,2,2-trifluoroethyl)furan-3-carboxamide.
| Compound Name | N-benzyl-2-chloro-N-(2,2,2-trifluoroethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106686196 |
| Molecular Formula | C14H11ClF3NO2 |
| Molecular Weight | 317.69 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-benzyl-2-chloro-N-(2,2,2-trifluoroethyl)furan-3-carboxamide |
| SMILES | O=C(c1ccoc1Cl)N(Cc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C14H11ClF3NO2/c15-12-11(6-7-21-12)13(20)19(9-14(16,17)18)8-10-4-2-1-3-5-10/h1-7H,8-9H2 |
| InChIKey | AYJPAJYCLFXALI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |