C16H18ClNO2 — CID 106686184
2-chloro-N-[(4-methylphenyl)methyl]-N-propylfuran-3-carboxamide (PubChem CID 106686184) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is 2-chloro-N-[(4-methylphenyl)methyl]-N-propylfuran-3-carboxamide.
| Compound Name | 2-chloro-N-[(4-methylphenyl)methyl]-N-propylfuran-3-carboxamide |
|---|---|
| PubChem CID | 106686184 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-chloro-N-[(4-methylphenyl)methyl]-N-propylfuran-3-carboxamide |
| SMILES | CCCN(Cc1ccc(C)cc1)C(=O)c1ccoc1Cl |
| InChI | InChI=1S/C16H18ClNO2/c1-3-9-18(11-13-6-4-12(2)5-7-13)16(19)14-8-10-20-15(14)17/h4-8,10H,3,9,11H2,1-2H3 |
| InChIKey | PMRQOZILUGGMEQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |