C13H14ClF3INO — CID 52637937
N-butyl-4-chloro-2-iodo-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 52637937) has the molecular formula C13H14ClF3INO and a molecular weight of 419.61 g/mol. Its IUPAC name is N-butyl-4-chloro-2-iodo-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-butyl-4-chloro-2-iodo-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 52637937 |
| Molecular Formula | C13H14ClF3INO |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | N-butyl-4-chloro-2-iodo-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)c1ccc(Cl)cc1I |
| InChI | InChI=1S/C13H14ClF3INO/c1-2-3-6-19(8-13(15,16)17)12(20)10-5-4-9(14)7-11(10)18/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | DFYTWHKGHGCCPG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|