C14H15N3OS — CID 17310338
N,N-bis(cyanomethyl)-2-propylsulfanylbenzamide (PubChem CID 17310338) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)-2-propylsulfanylbenzamide.
| Compound Name | N,N-bis(cyanomethyl)-2-propylsulfanylbenzamide |
|---|---|
| PubChem CID | 17310338 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N,N-bis(cyanomethyl)-2-propylsulfanylbenzamide |
| SMILES | CCCSc1ccccc1C(=O)N(CC#N)CC#N |
| InChI | InChI=1S/C14H15N3OS/c1-2-11-19-13-6-4-3-5-12(13)14(18)17(9-7-15)10-8-16/h3-6H,2,9-11H2,1H3 |
| InChIKey | DHWUETLYJOQMGE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|