C11H12N2OS — CID 60692429
2-(cyanomethylsulfanyl)-N,N-dimethylbenzamide (PubChem CID 60692429) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N,N-dimethylbenzamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 60692429 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccccc1SCC#N |
| InChI | InChI=1S/C11H12N2OS/c1-13(2)11(14)9-5-3-4-6-10(9)15-8-7-12/h3-6H,8H2,1-2H3 |
| InChIKey | OIMBPDRFEKNVPZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |