C16H22N2O2S — CID 66178952
2-(cyanomethylsulfanyl)-N-(2-hydroxy-2,4-dimethylpentyl)benzamide (PubChem CID 66178952) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-(2-hydroxy-2,4-dimethylpentyl)benzamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-(2-hydroxy-2,4-dimethylpentyl)benzamide |
|---|---|
| PubChem CID | 66178952 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-(2-hydroxy-2,4-dimethylpentyl)benzamide |
| SMILES | CC(C)CC(C)(O)CNC(=O)c1ccccc1SCC#N |
| InChI | InChI=1S/C16H22N2O2S/c1-12(2)10-16(3,20)11-18-15(19)13-6-4-5-7-14(13)21-9-8-17/h4-7,12,20H,9-11H2,1-3H3,(H,18,19) |
| InChIKey | JBEGVGMZYGQZSM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |